| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Axon MedChem BV | Netherlands | |||
|---|---|---|---|---|
![]() |
+31 (50) 311-8007 | |||
![]() |
order@axonmedchem.com | |||
| Chemical manufacturer | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | |||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Name | 7-(Dipropylamino)-5,6,7,8-Tetrahydronaphthalen-2-Ol |
|---|---|
| Synonyms | 3-(Dipropylamino)Tetralin-6-Ol; 3-(Dipropylamino)-6-Tetralinol; 7-(Dipropylamino)-5,6,7,8-Tetrahydro-2-Naphthalenol |
| Molecular Structure | ![]() |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 |
| CAS Registry Number | 74938-11-7 |
| SMILES | C1=C(O)C=CC2=C1CC(N(CCC)CCC)CC2 |
| InChI | 1S/C16H25NO/c1-3-9-17(10-4-2)15-7-5-13-6-8-16(18)12-14(13)11-15/h6,8,12,15,18H,3-5,7,9-11H2,1-2H3 |
| InChIKey | BLYMJBIZMIGWFK-UHFFFAOYSA-N |
| Density | 1.035g/cm3 (Cal.) |
|---|---|
| Boiling point | 383.818°C at 760 mmHg (Cal.) |
| Flash point | 178.503°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Diamandis et al.. Chemical genetics reveal a complex functional ground state of neural stem cells, Nature Chemical Biology, 2007 |
|---|---|
| Market Analysis Reports |