| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | (1Z,5Z,8S)-1,5-Dimethyl-8-Prop-1-En-2-Ylcyclodeca-1,5-Diene |
|---|---|
| Synonyms | (1Z,5Z,8S)-8-Isopropenyl-1,5-Dimethyl-Cyclodeca-1,5-Diene; (1Z,5Z,8S)-8-Isopropenyl-1,5-Dimethylcyclodeca-1,5-Diene; (1Z,5Z,8S)-1,5-Dimethyl-8-Prop-1-En-2-Yl-Cyclodeca-1,5-Diene |
| Molecular Structure | ![]() |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.35 |
| CAS Registry Number | 75023-40-4 (28387-44-2) |
| SMILES | [C@@H]1(C(=C)C)C/C=C(CC/C=C(CC1)/C)/C |
| InChI | 1S/C15H24/c1-12(2)15-10-8-13(3)6-5-7-14(4)9-11-15/h6,9,15H,1,5,7-8,10-11H2,2-4H3/b13-6-,14-9-/t15-/m0/s1 |
| InChIKey | XMRKUJJDDKYUHV-ZCGSDFCLSA-N |
| Density | 0.832g/cm3 (Cal.) |
|---|---|
| Boiling point | 281.753°C at 760 mmHg (Cal.) |
| Flash point | 112.892°C (Cal.) |
| (1) | Miller David J.. Competitive inhibition of aristolochene synthase by phenyl-substituted farnesyl diphosphates: evidence of active site plasticity, Organic & Biomolecular Chemistry, 2007 |
|---|---|
| Market Analysis Reports |