| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Bedoukian Research, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (203) 830-4000 | |||
![]() |
customerservice@bedoukian.com | |||
| Chemical manufacturer since 1972 | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Classification | Flavors and spices >> Synthetic spice >> Carboxylic acid and ester perfume >> Aromatic carboxylic acid ester |
|---|---|
| Name | Citronellyl Valerate |
| Synonyms | Pentanoic Acid 3,7-Dimethyloct-6-Enyl Ester; Valeric Acid 3,7-Dimethyloct-6-Enyl Ester; W231703_Aldrich |
| Molecular Structure | ![]() |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 |
| CAS Registry Number | 7540-53-6 |
| EINECS | 231-416-2 |
| FEMA | 2317 |
| SMILES | C(C(CCC=C(C)C)C)COC(=O)CCCC |
| InChI | 1S/C15H28O2/c1-5-6-10-15(16)17-12-11-14(4)9-7-8-13(2)3/h8,14H,5-7,9-12H2,1-4H3 |
| InChIKey | PFOJEJPZUVQHEH-UHFFFAOYSA-N |
| Density | 0.879g/cm3 (Cal.) |
|---|---|
| Boiling point | 237°C (Expl.) |
| 311.71°C at 760 mmHg (Cal.) | |
| Flash point | 94.223°C (Cal.) |
| Refractive index | 1.4435 (Expl.) |
| Market Analysis Reports |