|
CAS#: 7547-88-8 Product: Benzo[b]Quinolizinium Bromide No suppilers available for the product. |
| Name | Benzo[b]Quinolizinium Bromide |
|---|---|
| Synonyms | Benzo(B)Quinolizinium, Bromide; Nsc 81937; Benzo[B]Quinolizinium, Bromide |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10BrN |
| Molecular Weight | 260.13 |
| CAS Registry Number | 7547-88-8 |
| SMILES | C1=[N+]3C(=CC2=CC=CC=C12)C=CC=C3.[Br-] |
| InChI | 1S/C13H10N.BrH/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;/h1-10H;1H/q+1;/p-1 |
| InChIKey | PIYWJWXEZWYQDR-UHFFFAOYSA-M |
| (1) | Katja Faulhaber, Anton Granzhan, Heiko Ihmels, Daniela Otto, Laura Thomas and Sharon Wells. Studies of the fluorescence light-up effect of amino-substituted benzo[b]quinolizinium derivatives in the presence of biomacromolecules, Photochem. Photobiol. Sci., 2011, 10, 1535. |
|---|---|
| Market Analysis Reports |