| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Otava Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | |||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | Diethyl Tert-Butylmalonate |
|---|---|
| Synonyms | 2-Tert-Butylpropanedioic Acid Diethyl Ester; 2-Tert-Butylmalonic Acid Diethyl Ester; 278041_Aldrich |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 |
| CAS Registry Number | 759-24-0 |
| EINECS | 212-067-5 |
| SMILES | C(OC(C(C(OCC)=O)C(C)(C)C)=O)C |
| InChI | 1S/C11H20O4/c1-6-14-9(12)8(11(3,4)5)10(13)15-7-2/h8H,6-7H2,1-5H3 |
| InChIKey | RJNICNBRGVKNSR-UHFFFAOYSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| 0.978 (Expl.) | |
| Boiling point | 102-104°C (Expl.) |
| 222.4±8.0°C at 760 mmHg (Cal.) | |
| Flash point | 90°C (Expl.) |
| 90.556°C (Cal.) | |
| Refractive index | 1.425 (Expl.) |
| Safety Description | CAUTION: May irritate eyes, skin, and respiratory tract |
|---|---|
| SDS | Available |
| Market Analysis Reports |