|
CAS#: 7614-93-9 Product: 4-Phenylbut-3-en-2-ylbenzene No suppilers available for the product. |
| Name | 4-Phenylbut-3-en-2-ylbenzene |
|---|---|
| Synonyms | [(E)-4-Phenylbut-3-En-2-Yl]Benzene; (1-Methyl-3-Phenyl-Prop-2-Enyl)Benzene; [(E)-1-Methyl-3-Phenyl-Prop-2-Enyl]Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C16H16 |
| Molecular Weight | 208.30 |
| CAS Registry Number | 7614-93-9 |
| SMILES | C2=C(C(\C=C\C1=CC=CC=C1)C)C=CC=C2 |
| InChI | 1S/C16H16/c1-14(16-10-6-3-7-11-16)12-13-15-8-4-2-5-9-15/h2-14H,1H3/b13-12+ |
| InChIKey | GNQWHYWLSGTMSL-OUKQBFOZSA-N |
| Density | 1g/cm3 (Cal.) |
|---|---|
| Boiling point | 309.278°C at 760 mmHg (Cal.) |
| Flash point | 145.227°C (Cal.) |
| (1) | Cinzia Chiappe, Angelo Sanzone and Paul J. Dyson. Styrene oxidation by hydrogen peroxide in ionic liquids: the role of the solvent on the competition between two Pd-catalyzed processes, oxidation and dimerization, Green Chem., 2011, 13, 1437. |
|---|---|
| Market Analysis Reports |