| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Dibutylammonium Oleate |
|---|---|
| Synonyms | Dibutylamine; (Z)-Octadec-9-Enoic Acid; 9-Octadecenoic Acid (Z)-, Compd. With N-Butyl-1-Butanamine (1:1); Dibutylamine, Oleate |
| Molecular Structure | ![]() |
| Molecular Formula | C26H53NO2 |
| Molecular Weight | 411.71 |
| CAS Registry Number | 7620-75-9 |
| EINECS | 231-534-4 |
| SMILES | C(C(=O)O)CCCCCC\C=C/CCCCCCCC.C(NCCCC)CCC |
| InChI | 1S/C18H34O2.C8H19N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-3-5-7-9-8-6-4-2/h9-10H,2-8,11-17H2,1H3,(H,19,20);9H,3-8H2,1-2H3/b10-9-; |
| InChIKey | FJKPGTVTPYZWCM-KVVVOXFISA-N |
| Boiling point | 360°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 270.1°C (Cal.) |
| (1) | Georg Garnweitner and Markus Niederberger. Organic chemistry in inorganic nanomaterials synthesis, J. Mater. Chem., 2008, 18, 1171. |
|---|---|
| Market Analysis Reports |