| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 2-Amino-5-Phosphonopentanoic Acid |
|---|---|
| Synonyms | 2-Amino-5-Phosphono-Pentanoic Acid; 2-Amino-5-Phosphono-Valeric Acid; 2-Amino-5-Phosphopentanoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C5H12NO5P |
| Molecular Weight | 197.13 |
| CAS Registry Number | 76726-92-6 |
| SMILES | C([P](O)(O)=O)CCC(C(O)=O)N |
| InChI | 1S/C5H12NO5P/c6-4(5(7)8)2-1-3-12(9,10)11/h4H,1-3,6H2,(H,7,8)(H2,9,10,11) |
| InChIKey | VOROEQBFPPIACJ-UHFFFAOYSA-N |
| Density | 1.529g/cm3 (Cal.) |
|---|---|
| Boiling point | 482.14°C at 760 mmHg (Cal.) |
| Flash point | 245.389°C (Cal.) |
| solubility | Soluble to 10 mM in water and to 100 mM in 1eq. NaOH |
| Market Analysis Reports |