|
CAS#: 76822-93-0 Product: Carboxylic Acids, C16-18 And C18-Branched No suppilers available for the product. |
| Name | Carboxylic Acids, C16-18 And C18-Branched |
|---|---|
| Synonyms | (3S,6R)-3-Ethyl-6-Propyl-Undecanoic Acid; C16-C18 And C18 Branched Alkyl Carboxylic Acid; Carboxylic Acids, C16-18 And C18-Branched |
| Molecular Formula | C16H32O2 |
| Molecular Weight | 256.43 |
| CAS Registry Number | 76822-93-0 |
| SMILES | [C@H](CCCCC)(CCC)CC[C@H](CC)CC(O)=O |
| InChI | 1S/C16H32O2/c1-4-7-8-10-15(9-5-2)12-11-14(6-3)13-16(17)18/h14-15H,4-13H2,1-3H3,(H,17,18)/t14-,15+/m0/s1 |
| InChIKey | DXICFCIARASBNT-LSDHHAIUSA-N |
| Density | 0.89g/cm3 (Cal.) |
|---|---|
| Boiling point | 368.267°C at 760 mmHg (Cal.) |
| Flash point | 164.143°C (Cal.) |
| Market Analysis Reports |