| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Interbioscreen Ltd. | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (49) 6524-0091 | |||
![]() |
screen@ibscreen.chg.ru | |||
| Chemical manufacturer | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Name | 2-(3-Aminopropanoylamino)-3-(3H-Imidazol-4-Yl)Propanoic Acid |
|---|---|
| Synonyms | 2-[(3-Amino-1-Oxopropyl)Amino]-3-(3H-Imidazol-4-Yl)Propanoic Acid; 2-(3-Aminopropanoylamino)-3-(3H-Imidazol-4-Yl)Propionic Acid; .Beta.-Alanyl-L-Histidine |
| Molecular Structure | ![]() |
| Molecular Formula | C9H14N4O3 |
| Molecular Weight | 226.23 |
| CAS Registry Number | 7683-28-5 |
| SMILES | C1=C([NH]C=N1)CC(NC(=O)CCN)C(=O)O |
| InChI | 1S/C9H14N4O3/c10-2-1-8(14)13-7(9(15)16)3-6-4-11-5-12-6/h4-5,7H,1-3,10H2,(H,11,12)(H,13,14)(H,15,16) |
| InChIKey | CQOVPNPJLQNMDC-UHFFFAOYSA-N |
| Density | 1.376g/cm3 (Cal.) |
|---|---|
| Boiling point | 656.236°C at 760 mmHg (Cal.) |
| Flash point | 350.679°C (Cal.) |
| (1) | Huibin Wei, Haifang Li, Dan Gao and Jin-Ming Lin. Multi-channel microfluidic devices combined with electrospray ionization quadrupole time-of-flight mass spectrometry applied to the monitoring of glutamate release from neuronal cells, Analyst, 2010, 135, 2043. |
|---|---|
| Market Analysis Reports |