| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Fluorochem Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Name | 2-Ethenyl-1,1-Cyclopropanedicarboxylicacid 1,1-Diethyl Ester |
|---|---|
| Synonyms | Diethyl 2-Vinylcyclopropane-1,1-Dicarboxylate; 2-Vinylcyclopropane-1,1-Dicarboxylic Acid Diethyl Ester; Ghl.Pd_Mitscher_Leg0.115 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.25 |
| CAS Registry Number | 7686-78-4 |
| EINECS | 231-695-0 |
| SMILES | C(OC(=O)C1(C(C1)C=C)C(OCC)=O)C |
| InChI | 1S/C11H16O4/c1-4-8-7-11(8,9(12)14-5-2)10(13)15-6-3/h4,8H,1,5-7H2,2-3H3 |
| InChIKey | UOQTXZICFVMERR-UHFFFAOYSA-N |
| Density | 1.174g/cm3 (Cal.) |
|---|---|
| Boiling point | 230.627°C at 760 mmHg (Cal.) |
| Flash point | 101.586°C (Cal.) |
| (1) | Nikhil Kumar Singha, Amalin Kavitha, Prodip Sarker and Stephen Rimmer. Copper-mediated controlled radical ring-opening polymerization (RROP) of a vinylcycloalkane, Chem. Commun., 2008, 3049. |
|---|---|
| Market Analysis Reports |