| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| MP Biomedicals LLC. | USA | |||
|---|---|---|---|---|
![]() |
+1 (440) 337-1200 | |||
![]() |
info@mpbio.com | |||
| Chemical manufacturer | ||||
| Classification | Inorganic chemical industry >> Inorganic salt >> Phosphides, metal phosphoric acid, metaphosphoric acid, hypophosphorous acid and pyrophosphate |
|---|---|
| Name | (2-Bromo-2-Ethylbutyryl)Urea |
| Synonyms | 2-Bromo-N-Carbamoyl-2-Ethyl-Butanamide; 2-Bromo-N-Carbamoyl-2-Ethyl-Butyramide; N-Aminocarbonyl-2-Bromo-2-Ethyl-Butanamide |
| Molecular Structure | ![]() |
| Molecular Formula | C7H13BrN2O2 |
| Molecular Weight | 237.10 |
| CAS Registry Number | 77-65-6 |
| EINECS | 201-046-6 |
| SMILES | C(C(C(NC(N)=O)=O)(CC)Br)C |
| InChI | 1S/C7H13BrN2O2/c1-3-7(8,4-2)5(11)10-6(9)12/h3-4H2,1-2H3,(H3,9,10,11,12) |
| InChIKey | OPNPQXLQERQBBV-UHFFFAOYSA-N |
| Density | 1.445g/cm3 (Cal.) |
|---|---|
| (1) | Hatem M. Titi and Israel Goldberg. Crystal engineering with 1-benzofuran-2,3-dicarboxylic acid: co-crystals with bipyridyl ligands, discrete complexes and coordination polymers with metal ions, CrystEngComm, 2010, 12, 3914. |
|---|---|
| Market Analysis Reports |