| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Asinex Ltd. | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (495) 780-3415 / 780-3417 | |||
![]() |
lsadovenko@asinex.com, | |||
| Chemical manufacturer | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Name | 2,2'-[1,4-Butanediylbis(oxy)]dibenzaldehyde |
|---|---|
| Synonyms | 1,4-bis(2-formylphenoxy)butane; 2,2'-(1,4-Butanediyldioxy) bisbenzaldehyde; 2,2'-(1,4-Butanediyldioxy)bisbenzaldehyde |
| Molecular Structure | ![]() |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.33 |
| CAS Registry Number | 77354-98-4 |
| SMILES | C1=CC=C(C(=C1)C=O)OCCCCOC2=CC=CC=C2C=O |
| InChI | 1S/C18H18O4/c19-13-15-7-1-3-9-17(15)21-11-5-6-12-22-18-10-4-2-8-16(18)14-20/h1-4,7-10,13-14H,5-6,11-12H2 |
| InChIKey | WNEFNKQASOEBOX-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 494.3±30.0°C at 760 mmHg (Cal.) |
| Flash point | 219.4±24.6°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Jolanta Maslinska-Solich, Nikodem Kuznik, Maciej Kubicki and Sylwia Kukowka. The formation of a cyclic diacetal of methyl a-D-mannopyranoside with a 16-membered macrocyclic loop, Chem. Commun., 2002, 0, 984. |
|---|---|
| Market Analysis Reports |