| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Glentham Life Sciences | UK | |||
|---|---|---|---|---|
![]() |
+44 (2033) 978-798 | |||
![]() |
info@glenthamls.com | |||
| Chemical distributor since 2013 | ||||
| Name | 6-Nitro-2-Piperazin-1-Yl-Quinoline |
|---|---|
| Synonyms | 6-Nitro-2-Piperazin-1-Yl-Quinoline; 6-Nitro-2-(1-Piperazinyl)Quinoline; Ncgc00162315-02 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H14N4O2 |
| Molecular Weight | 258.28 |
| CAS Registry Number | 77372-73-7 |
| SMILES | C1=CC(=CC2=CC=C(N=C12)N3CCNCC3)[N+](=O)[O-] |
| InChI | 1S/C13H14N4O2/c18-17(19)11-2-3-12-10(9-11)1-4-13(15-12)16-7-5-14-6-8-16/h1-4,9,14H,5-8H2 |
| InChIKey | GGDBEAVVGFNWIA-UHFFFAOYSA-N |
| Density | 1.312g/cm3 (Cal.) |
|---|---|
| Boiling point | 484.353°C at 760 mmHg (Cal.) |
| Flash point | 246.728°C (Cal.) |
| (1) | Kokel et al.. Rapid behavior-based identification of neuroactive small molecules in the zebrafish, Nature Chemical Biology, 2010 |
|---|---|
| Market Analysis Reports |