| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Classification | Inorganic chemical industry >> Inorganic salt >> Metal halides and halides >> Metal iodide and salt |
|---|---|
| Name | Mercuric Iodate |
| Synonyms | Mercuric Iodate |
| Molecular Structure | ![]() |
| Molecular Formula | HgI2O6 |
| Molecular Weight | 550.40 |
| CAS Registry Number | 7783-32-6 |
| EINECS | 231-989-9 |
| SMILES | [I]([O-])(=O)=O.[I]([O-])(=O)=O.[Hg] |
| InChI | 1S/Hg.2HIO3/c;2*2-1(3)4/h;2*(H,2,3,4)/p-2 |
| InChIKey | LXQRSYWGILKFNR-UHFFFAOYSA-L |
| Market Analysis Reports |