| Atomax Chemicals Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3-Hexyl-6-methyl-1,4-dioxane-2,5-dione |
|---|---|
| Synonyms | 3-hexyl-6-methyl-1,4-dioxane-2,5-dione; 3-methyl-6-n-hexyl-1,4-dioxane-2,5-dione |
| Molecular Structure | ![]() |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 |
| CAS Registry Number | 779355-47-4 |
| SMILES | CCCCCCC1C(=O)OC(C(=O)O1)C |
| InChI | 1S/C11H18O4/c1-3-4-5-6-7-9-11(13)14-8(2)10(12)15-9/h8-9H,3-7H2,1-2H3 |
| InChIKey | BSDLHDSKWLPXIW-UHFFFAOYSA-N |
| Density | 1.045g/cm3 (Cal.) |
|---|---|
| Boiling point | 345.462°C at 760 mmHg (Cal.) |
| Flash point | 172.498°C (Cal.) |
| Refractive index | 1.444 (Cal.) |
| (1) | Ryan J. Pounder, Helen Willcock, Nga Sze Ieong, Rachel K. O'Reilly and Andrew P. Dove. Stereocomplexation in novel degradable amphiphilic block copolymer micelles of poly(ethylene oxide) and poly(benzyl a-malate), Soft Matter, 2011, 7, 10987. |
|---|---|
| Market Analysis Reports |