|
CAS#: 78210-35-2 Product: 2-Naphthalen-2-Ylphenol No suppilers available for the product. |
| Name | 2-Naphthalen-2-Ylphenol |
|---|---|
| Synonyms | 2-(2-Naphthyl)Phenol; O-(2-Naphthyl)Phenol |
| Molecular Structure | ![]() |
| Molecular Formula | C16H12O |
| Molecular Weight | 220.27 |
| CAS Registry Number | 78210-35-2 |
| EINECS | 278-871-3 |
| SMILES | C2=C(C1=C(O)C=CC=C1)C=CC3=C2C=CC=C3 |
| InChI | 1S/C16H12O/c17-16-8-4-3-7-15(16)14-10-9-12-5-1-2-6-13(12)11-14/h1-11,17H |
| InChIKey | DYXBPOGHFMDEDL-UHFFFAOYSA-N |
| Density | 1.176g/cm3 (Cal.) |
|---|---|
| Boiling point | 381.114°C at 760 mmHg (Cal.) |
| Flash point | 183.414°C (Cal.) |
| (1) | Fang Guo, Ming-qian Zhang, Na Lu, Hong-yu Guan, Jian Tong and Bao-xin Wang. Co-crystal of [CuCl4]2 and L1 and its inclusion compounds with three different guests (L1 = N,N,N′,N′-tetra-p-methoxybenzyl-ethylenediamine), CrystEngComm, 2011, 13, 6753. |
|---|---|
| Market Analysis Reports |