| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 2-Amino-3,7-Dimethylimidazo[4,5-f]Quinoxaline |
|---|---|
| Synonyms | 3,7-Dimethyl-2-Imidazo[4,5-F]Quinoxalinamine; (3,7-Dimethylimidazo[4,5-F]Quinoxalin-2-Yl)Amine; Ccris 2537 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H11N5 |
| Molecular Weight | 213.24 |
| CAS Registry Number | 78411-56-0 |
| SMILES | C2=CC1=NC(=CN=C1C3=C2[N](C)C(=N3)N)C |
| InChI | 1S/C11H11N5/c1-6-5-13-9-7(14-6)3-4-8-10(9)15-11(12)16(8)2/h3-5H,1-2H3,(H2,12,15) |
| InChIKey | LDBGZSRZUHNKMJ-UHFFFAOYSA-N |
| Density | 1.48g/cm3 (Cal.) |
|---|---|
| Boiling point | 458.395°C at 760 mmHg (Cal.) |
| Flash point | 231.029°C (Cal.) |
| (1) | Powers RA, Morandi F, Shoichet BK. Structure-based discovery of a novel, noncovalent inhibitor of AmpC beta-lactamase., Structure. 2002 Jul;10(7):1013-23 |
|---|---|
| Market Analysis Reports |