| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Bide Pharmatech Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 4006-147-117 | |||
![]() |
sales@bidepharmatech.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer since 2007 | ||||
| ChemDiv, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 794-4860 | |||
![]() |
chemdiv@chemdiv.com | |||
| Chemical manufacturer | ||||
| King Scientific | USA | |||
|---|---|---|---|---|
![]() |
sales@kingscientific.com | |||
| Chemical manufacturer since 2013 | ||||
| Manchester Organics Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1928) 710-200 | |||
![]() |
info@manchesterorganics.com | |||
| Chemical manufacturer | ||||
| Matrix Scientific Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Vitas-M | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (906) 781-2021 | |||
![]() |
vitas@vitasmlab.com | |||
| Chemical manufacturer since 1998 | ||||
| Name | 4,4'-Methylenebis[2-Chloro-Benzenamine] |
|---|---|
| Synonyms | 4-[(4-Amino-3-Chloro-Phenyl)Methyl]-2-Chloro-Aniline; [4-(4-Amino-3-Chloro-Benzyl)-2-Chloro-Phenyl]Amine; Mboca |
| Molecular Formula | C13H12Cl2N2 |
| Molecular Weight | 267.16 |
| CAS Registry Number | 78642-65-6 |
| SMILES | C2=C(CC1=CC(=C(N)C=C1)Cl)C=CC(=C2Cl)N |
| InChI | 1S/C13H12Cl2N2/c14-10-6-8(1-3-12(10)16)5-9-2-4-13(17)11(15)7-9/h1-4,6-7H,5,16-17H2 |
| InChIKey | IBOFVQJTBBUKMU-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 108°C (Expl.) |
| Boiling point | 537.5358-557.2661°C (Expl.) |
| 412.0±40.0°C at 760 mmHg (Cal.) | |
| Flash point | 203.0±27.3°C (Cal.) |
| solubility | Slight |
| (1) | Elmira Badamshina, Yakov Estrin and Margarita Gafurova. Nanocomposites based on polyurethanes and carbon nanoparticles: preparation, properties and application, J. Mater. Chem. A, 2013, 1, 6509. |
|---|---|
| Market Analysis Reports |