| Asinex Ltd. | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (495) 780-3415 / 780-3417 | |||
![]() |
lsadovenko@asinex.com, | |||
| Chemical manufacturer | ||||
| ChemDiv, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 794-4860 | |||
![]() |
chemdiv@chemdiv.com | |||
| Chemical manufacturer | ||||
| Princeton BioMolecular Research, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (732) 355-9920 | |||
![]() |
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Vitas-M | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (906) 781-2021 | |||
![]() |
vitas@vitasmlab.com | |||
| Chemical manufacturer since 1998 | ||||
| ZereneX Molecular Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Name | 7-Chloro-3',4,6-Trimethoxy-5'-Methylspiro[1-Benzofuran-2,4'-Cyclohex-2-Ene]-1',3-Dione |
|---|---|
| Synonyms | 7-Chloro-3',4,6-Trimethoxy-5'-Methyl-Spiro[Benzofuran-2,4'-Cyclohex-2-Ene]-1',3-Dione; 7-Chloro-3',4,6-Trimethoxy-5'-Methylspiro[Benzofuran-2,4'-Cyclohex-2-Ene]-1',3-Dione; 7-Chloro-3',4,6-Trimethoxy-5'-Methyl-Spiro[Benzofuran-2,4'-Cyclohex-2-Ene]-1',3-Quinone |
| Molecular Structure | ![]() |
| Molecular Formula | C17H17ClO6 |
| Molecular Weight | 352.77 |
| CAS Registry Number | 78739-00-1 |
| SMILES | C3=C(C1=C(OC2(C1=O)C(=CC(=O)CC2C)OC)C(=C3OC)Cl)OC |
| InChI | 1S/C17H17ClO6/c1-8-5-9(19)6-12(23-4)17(8)16(20)13-10(21-2)7-11(22-3)14(18)15(13)24-17/h6-8H,5H2,1-4H3 |
| InChIKey | DDUHZTYCFQRHIY-UHFFFAOYSA-N |
| Density | 1.383g/cm3 (Cal.) |
|---|---|
| Boiling point | 570.366°C at 760 mmHg (Cal.) |
| Flash point | 228.003°C (Cal.) |
| (1) | Mehran Yazdanian, Susan L. Glynn, James L. Wright and Amale Hawi. Correlating Partitioning and Caco-2 Cell Permeability of Structurally Diverse Small Molecular Weight Compounds, Pharm. Res. 1998, 15(9), 1490-1494 |
|---|---|
| Market Analysis Reports |