| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Classification | API >> Hormone and endocrine-regulating drugs >> Estrogen and progestogen drugs |
|---|---|
| Name | (6A,17B)-17-Hydroxy-6-Methyl-17-(1-Propynyl)-Androst-4-En-3-One |
| Synonyms | Dimethisterone; D02298; Dimethisterone (Jan/Usan) |
| Molecular Structure | ![]() |
| Molecular Formula | C23H34O3 |
| Molecular Weight | 358.52 |
| CAS Registry Number | 79-64-1 |
| EINECS | 201-215-4 |
| SMILES | [C@@H]14[C@](CC[C@H]2[C@H]1C[C@@H](C3=CC(=O)CC[C@]23C)C)([C@@](O)(CC4)C#CC)C.O |
| InChI | 1S/C23H32O2.H2O/c1-5-9-23(25)12-8-19-17-13-15(2)20-14-16(24)6-10-21(20,3)18(17)7-11-22(19,23)4;/h14-15,17-19,25H,6-8,10-13H2,1-4H3;1H2/t15-,17+,18-,19-,21+,22-,23-;/m0./s1 |
| InChIKey | REHJTMDOJHAPJV-IVTQUDKZSA-N |
| Market Analysis Reports |