| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Indofine Chemical Company, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (908) 359-6778 | |||
![]() |
fo@indofinechemical.com | |||
| Chemical manufacturer since 1996 | ||||
| P and M Invest Ltd. | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| Classification | Organic raw materials >> Hydrocarbon compounds and their derivatives >> Hydrocarbon halide |
|---|---|
| Name | Heptafluorobenzyl Iodide |
| Synonyms | HEPTAFLUOROBENZYL IODIDE, TECH.; HEPTAFLUOROBENZYL IODIDE 95%; Heptafluorobenzyliodide97% |
| Molecular Structure | ![]() |
| Molecular Formula | C7F7I |
| Molecular Weight | 343.97 |
| CAS Registry Number | 79865-03-5 |
| SMILES | Fc1c(F)c(F)c(c(c1F)C(I)(F)F)F |
| InChI | 1S/C7F7I/c8-2-1(7(13,14)15)3(9)5(11)6(12)4(2)10 |
| SDS | Available |
|---|---|
| Market Analysis Reports |