| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 5,5-Diethyl-1,3-Diazinane-2,4,6-Trione, 4-Dimethylamino-1,5-Dimethyl-2 -Phenyl-Pyrazol-3-One |
|---|---|
| Synonyms | 3H-Pyrazol-3-One, 4-(Dimethylamino)-1,2-Dihydro-1,5-Dimethyl-2-Phenyl-, Mixt. Contg.; 5,5-Diethyl-2,4,6(1H,3H,5H)-Pyrimidinetrione, Mixt. With 4-(Dimethylamino)-1,2-Dihydro-1,5-Dimethyl-2-Phenyl-3H-Pyrazol-3-One; Amidopyrine Compd. With Barbital (1:1) |
| Molecular Structure | ![]() |
| Molecular Formula | C21H29N5O4 |
| Molecular Weight | 415.49 |
| CAS Registry Number | 8015-18-7 |
| SMILES | C2=C(N1N(C(=C(N(C)C)C1=O)C)C)C=CC=C2.C(C3(C(=O)NC(=O)NC3=O)CC)C |
| InChI | 1S/C13H17N3O.C8H12N2O3/c1-10-12(14(2)3)13(17)16(15(10)4)11-8-6-5-7-9-11;1-3-8(4-2)5(11)9-7(13)10-6(8)12/h5-9H,1-4H3;3-4H2,1-2H3,(H2,9,10,11,12,13) |
| InChIKey | OUTUZEBQXNEVGY-UHFFFAOYSA-N |
| Boiling point | 319.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 125.9°C (Cal.) |
| Market Analysis Reports |