| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Benzointincture |
|---|---|
| Synonyms | Benzoin (Jp15/Usp); Fenyl-Alpha-Hydroxybenzylketon [Czech]; Benjamin Gum |
| Molecular Structure | ![]() |
| Molecular Formula | C14H12O2 |
| Molecular Weight | 212.25 |
| CAS Registry Number | 8050-35-9 |
| SMILES | C1=CC=CC=C1C(C(C2=CC=CC=C2)=O)O |
| InChI | 1S/C14H12O2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13,15H |
| InChIKey | ISAOCJYIOMOJEB-UHFFFAOYSA-N |
| Density | 1.31 (Expl.) |
|---|---|
| 1.2±0.1g/cm3 (Cal.) | |
| Melting point | 135°C (Expl.) |
| Boiling point | 342.999°C at 760 mmHg (Cal.) |
| 194°C (Expl.) | |
| Flash point | 181°C (Expl.) |
| 154.8±14.9°C (Cal.) | |
| Safety Description | CAUTION: May irritate eyes, skin, and respiratory tract |
|---|---|
| Minimize exposure. | |
| (1) | Saravanakumar Shanmuganathan, Dessy Natalia, Anne van den Wittenboer, Christina Kohlmann, Lasse Greiner and Pablo Domínguez de María. Enzyme-catalyzed C–C bond formation using 2-methyltetrahydrofuran (2-MTHF) as (co)solvent: efficient and bio-based alternative to DMSO and MTBE, Green Chem., 2010, 12, 2240. |
|---|---|
| Market Analysis Reports |