|
CAS#: 80539-94-2 Product: Proksifein No suppilers available for the product. |
| Name | Proksifein |
|---|---|
| Synonyms | 3,5-Dihydropurine-6-Thione; 8-(3-Dimethylaminopropoxy)-1,3,7-Trimethyl-Purine-2,6-Dione; 3,5-Dihydropurine-6-Thione; 8-(3-Dimethylaminopropoxy)-1,3,7-Trimethyl-Xanthine; 1H-Purine-2,6-Dione, 8-[3-(Dimethylamino)Propoxy]-3,7- Dihydro-1,3,7-Trimethyl-, Mixt. With 1,7-Dihydro-6H- Purine-6-Thione |
| Molecular Structure | ![]() |
| Molecular Formula | C18H25N9O3S |
| Molecular Weight | 447.51 |
| CAS Registry Number | 80539-94-2 |
| SMILES | C1(=S)N=CNC2=NC=NC12.C(COC3=NC4=C([N]3C)C(=O)N(C(=O)N4C)C)CN(C)C |
| InChI | 1S/C13H21N5O3.C5H4N4S/c1-15(2)7-6-8-21-12-14-10-9(16(12)3)11(19)18(5)13(20)17(10)4;10-5-3-4(7-1-6-3)8-2-9-5/h6-8H2,1-5H3;1-3H,(H,6,7,8,9,10) |
| InChIKey | SHQNHQQMKUHELL-UHFFFAOYSA-N |
| Boiling point | 454.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 228.7°C (Cal.) |
| Market Analysis Reports |