|
CAS#: 8066-01-1 Product: Di-Trapex No suppilers available for the product. |
| Name | Di-Trapex |
|---|---|
| Synonyms | 1-Propene, 1,3-Dichloro-, Mixt. With 1,2-Dichloropropane And Isothiocyanatomethane; Dd - Methyl Isothiocyanate Mixt.; Dd Me Isothiocyanate Mixt. |
| Molecular Structure | ![]() |
| Molecular Formula | C6H8Cl4 |
| Molecular Weight | 221.94 |
| CAS Registry Number | 8066-01-1 (8070-55-1) |
| SMILES | C(\C=C/Cl)Cl.C(\C=C\Cl)Cl |
| InChI | 1S/2C3H4Cl2/c2*4-2-1-3-5/h2*1-2H,3H2/b2-1+;2-1- |
| InChIKey | YVPVBTOOGFLALI-KDTZGSNLSA-N |
| Boiling point | 108.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 27.8°C (Cal.) |
| Market Analysis Reports |