| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Classification | API >> Hormone and endocrine-regulating drugs >> Pancreatic hormones and other blood sugar regulating drugs |
|---|---|
| Name | 1,5-Dideoxy-1,5-[[2-[4-(Ethoxycarbonyl)Phenoxy]Ethyl]Imino]-D-Glucitol |
| Synonyms | Ethyl 4-[2-[(2R,3R,4R,5S)-3,4,5-Trihydroxy-2-(Hydroxymethyl)-1-Piperidyl]Ethoxy]Benzoate; 4-[2-[(2R,3R,4R,5S)-3,4,5-Trihydroxy-2-(Hydroxymethyl)-1-Piperidinyl]Ethoxy]Benzoic Acid Ethyl Ester; 4-[2-[(2R,3R,4R,5S)-3,4,5-Trihydroxy-2-Methylol-1-Piperidyl]Ethoxy]Benzoic Acid Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C17H25NO7 |
| Molecular Weight | 355.39 |
| CAS Registry Number | 80879-63-6 |
| EINECS | 279-613-2 |
| SMILES | [C@@H]1(N(C[C@H](O)[C@H]([C@@H]1O)O)CCOC2=CC=C(C(OCC)=O)C=C2)CO |
| InChI | 1S/C17H25NO7/c1-2-24-17(23)11-3-5-12(6-4-11)25-8-7-18-9-14(20)16(22)15(21)13(18)10-19/h3-6,13-16,19-22H,2,7-10H2,1H3/t13-,14+,15-,16-/m1/s1 |
| InChIKey | NWWORXYTJRPSMC-QKPAOTATSA-N |
| Density | 1.329g/cm3 (Cal.) |
|---|---|
| Boiling point | 580.167°C at 760 mmHg (Cal.) |
| Flash point | 304.674°C (Cal.) |
| Market Analysis Reports |