| Carbosynth China Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (512) 6260-5585 | |||
![]() |
sales@carbosynth.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink massive supplier since 2016 | ||||
| Anvia Chemicals, LLC | USA | |||
|---|---|---|---|---|
![]() |
+1 (414) 534-7845 | |||
![]() |
sales@anviachem.com | |||
| Chemical manufacturer | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Chem Service, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (610) 692-3026 | |||
![]() |
info@chemservice.com | |||
| Chemical manufacturer since 1962 | ||||
| Classification | Organic raw materials >> Amino compound >> Acyclic monoamines, polyamines and their derivatives and salts |
|---|---|
| Name | Tris(2-Chloroethyl)Amine Hydrochloride |
| Synonyms | Tris(2-Chloroethyl)Amine Hydrochloride; Trimustine; Spectrum300563 |
| Molecular Structure | ![]() |
| Molecular Formula | C6H13Cl4N |
| Molecular Weight | 240.99 |
| CAS Registry Number | 817-09-4 |
| EINECS | 212-442-3 |
| SMILES | [H+].C(N(CCCl)CCCl)CCl.[Cl-] |
| InChI | 1S/C6H12Cl3N.ClH/c7-1-4-10(5-2-8)6-3-9;/h1-6H2;1H |
| InChIKey | VEAUDLLZYJVHRI-UHFFFAOYSA-N |
| Boiling point | 156.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 48.3°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |