Online Database of Chemicals from Around the World

Methyl 2-(2-methoxycarbonylphenoxy)carbonyloxybenzoate
[CAS 82091-12-1]

List of Suppliers
Shanghai Zhuyao Pharmaceutical Technology Co., Ltd. China
cn.pharmalego.com
+86 (021) 5859-6383
marketing@pharmalego.com
QQ Chat
Chemical manufacturer since 2023
chemBlink Standard supplier since 2024

Identification
ClassificationOrganic raw materials >> Carboxylic compounds and derivatives >> Carboxylic esters and their derivatives
NameMethyl 2-(2-methoxycarbonylphenoxy)carbonyloxybenzoate
SynonymsDimethyl 2,2'-(carbonylbis(oxy))dibenzoate; Bis(2-(methoxycarbonyl)phenyl) carbonate
Molecular StructureMethyl 2-(2-methoxycarbonylphenoxy)carbonyloxybenzoate molecular structure (CAS 82091-12-1)
Molecular FormulaC17H14O7
Molecular Weight330.29
CAS Registry Number82091-12-1
EC Number622-061-8
SMILESCOC(=O)C1=CC=CC=C1OC(=O)OC2=CC=CC=C2C(=O)OC
Properties
Density1.3±0.1 g/cm3, Calc.*
Index of Refraction1.563, Calc.*
Boiling Point457.9±30.0 °C (760 mmHg), Calc.*
Flash Point202.5±24.6 °C, Calc.*
*Calculated using Advanced Chemistry Development (ACD/Labs) Software.
Safety Data
Hazard Symbolssymbol symbol symbol   GHS07;GHS08;GHS09 Danger  Details
Risk StatementsH302-H319-H372-H410  Details
Safety StatementsP501-P273-P260-P270-P264-P280-P391-P314-P337+P313-P305+P351+P338-P301+P312+P330  Details
Hazard Classification
up    Details
HazardClassCategory CodeHazard Statement
Acute hazardous to the aquatic environmentAquatic Acute1H400
Transport InformationUN 3077
SDSAvailable
up Discovery and Applications
Methyl 2-(2-methoxycarbonylphenoxy)carbonyloxybenzoate is an organic compound that belongs to the ester class of chemicals. It consists of a complex molecular structure comprising aromatic rings and ester functional groups. This substance features a benzoate group attached to a carbonyloxyphenyl group, with a methoxycarbonyl group on the second phenyl ring, providing it with a functionalized and reactive chemical structure. Such compounds often serve as versatile intermediates in the synthesis of various organic materials and bioactive molecules.

The discovery of methyl 2-(2-methoxycarbonylphenoxy)carbonyloxybenzoate likely occurred through ongoing efforts in synthetic organic chemistry to explore the chemical properties and potential applications of functionalized aromatic esters. Researchers have long been interested in the reactivity of ester groups, as they can undergo a range of transformations that are valuable in the creation of more complex molecules. The presence of methoxy and carbonyloxy groups in the compound allows for specific reactivity that is exploited in various synthetic pathways, making this substance a useful building block in chemical synthesis.

In terms of applications, methyl 2-(2-methoxycarbonylphenoxy)carbonyloxybenzoate has been primarily utilized in the field of organic synthesis, where it acts as an intermediate in the preparation of various other chemical entities. The ester functional group is known for its ability to undergo hydrolysis, transesterification, and other reactions, which makes this compound a useful reagent in chemical laboratories. Researchers can utilize its reactivity to modify the structure of other molecules, enabling the creation of a wide array of derivatives with desired properties.

This compound has also shown potential in the development of new materials. Esters like methyl 2-(2-methoxycarbonylphenoxy)carbonyloxybenzoate can be incorporated into polymeric systems to impart specific functionalities. Its ability to serve as a monomer in the synthesis of polyesters or copolymers has led to interest in its potential application in the production of specialty plastics and coatings. These materials can exhibit desirable properties such as improved durability, flexibility, or resistance to environmental factors, depending on the composition of the polymer system.

In addition to material science, methyl 2-(2-methoxycarbonylphenoxy)carbonyloxybenzoate has potential applications in medicinal chemistry. Compounds with similar structures have been explored for their ability to interact with various biological targets. The ester group and aromatic rings could enable interactions with enzymes or receptors, offering potential pharmacological activity. While further research is needed to fully explore its medicinal properties, its structural features make it a candidate for further investigation in drug discovery.

In conclusion, methyl 2-(2-methoxycarbonylphenoxy)carbonyloxybenzoate is a versatile compound that plays a role in both synthetic chemistry and material science. Its ability to undergo a variety of chemical transformations and its potential for incorporation into polymers and bioactive molecules makes it a valuable substance for researchers. Further exploration of its properties could lead to new applications in a range of fields, from pharmaceuticals to advanced materials.

References

none
Market Analysis Reports
Related Products
Methyl 1-[6-(8-...  3-Methyl-5-Meth...  Methyl 7-[2-[2-...  Methyl 6-[[2-[3...  Methyl 2-(2-Met...  Methyl 2-[(Meth...  Methyl 1-[(Meth...  Methyl 3-[(meth...  Methyl 3-(metho...  Methyl 2-Methox...  Methyl N-(Metho...  Methyl 2-(Metho...  3-Methyl-5-meth...  Methyl 2-[(2-{[...  Methyl 4-[2-(4-...  Methyl 2-[(E)-2...  N-Methyl-3-[3-(...  Methyl N-(Metho...  O-Methyl [4-(Me...  N-Methyl-N-meth...