|
CAS#: 82467-51-4 Product: Rubschisandrin No suppilers available for the product. |
| Name | Rubschisandrin |
|---|---|
| Synonyms | (-)-Gamma-Schizandrin; Aids-057842; Gomisin L1 Methyl Ether |
| Molecular Structure | ![]() |
| Molecular Formula | C23H28O6 |
| Molecular Weight | 400.47 |
| CAS Registry Number | 82467-51-4 |
| SMILES | [C@H]2(CC4=C(C1=C(C=C(OC)C(=C1OC)OC)C[C@@H]2C)C(=C3OCOC3=C4)OC)C |
| InChI | 1S/C23H28O6/c1-12-7-14-9-16(24-3)20(25-4)22(26-5)18(14)19-15(8-13(12)2)10-17-21(23(19)27-6)29-11-28-17/h9-10,12-13H,7-8,11H2,1-6H3/t12-,13+/m0/s1 |
| InChIKey | RTZKSTLPRTWFEV-QWHCGFSZSA-N |
| Density | 1.148g/cm3 (Cal.) |
|---|---|
| Boiling point | 544.968°C at 760 mmHg (Cal.) |
| Flash point | 220.392°C (Cal.) |
| (1) | L.-W. Wang, T. Chen, H.-X. Sun, Y. Xiong, C.-X. Zhou and Y. Zhao. Kadsuranin: a lignan from the fruit of Schisandra chinensis, Acta Cryst. (2004). E60, o513-o514 |
|---|---|
| Market Analysis Reports |