| Acorn PharmaTech, LLC | USA | |||
|---|---|---|---|---|
![]() |
+1 (650) 353-2487 | |||
![]() |
sales@acornpharmatech.com | |||
| Chemical manufacturer | ||||
| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Enamine Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 537-3218 | |||
![]() |
enamine@enamine.net | |||
| Chemical manufacturer since 1991 | ||||
| HDH Pharma, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 451-2028 | |||
![]() |
catalog@hdhpharma.com | |||
| Chemical manufacturer since 2008 | ||||
| LeadGen Labs, LLC | USA | |||
|---|---|---|---|---|
![]() |
+1 (203) 645-8468 | |||
![]() |
info@leadgenlabs.com | |||
| Chemical manufacturer | ||||
| Matrix Scientific Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | |||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Specs Ltd. | Netherlands | |||
|---|---|---|---|---|
![]() |
+31 (15) 251-8111 | |||
![]() |
info@specs.net | |||
| Chemical manufacturer since 1987 | ||||
| Classification | Chemical reagent >> Organic reagent >> Polycyclic compound |
|---|---|
| Name | Thianaphthene-1,1-Dioxide |
| Synonyms | Benzothiophene 1,1-Dioxide; Ac-907/25014199; Inchi=1/C8h6o2s/C9-11(10)6-5-7-3-1-2-4-8(7)11/H1-6 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H6O2S |
| Molecular Weight | 166.19 |
| CAS Registry Number | 825-44-5 |
| EINECS | 212-544-8 |
| SMILES | C1=CC=CC2=C1[S](=O)(=O)C=C2 |
| InChI | 1S/C8H6O2S/c9-11(10)6-5-7-3-1-2-4-8(7)11/h1-6H |
| InChIKey | FRJNKYGTHPUSJR-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 137-138°C (Expl.) |
| Boiling point | 371.1±25.0°C at 760 mmHg (Cal.) |
| Flash point | 244.0±15.8°C (Cal.) |
| Safety Description | CAUTION: May irritate eyes, skin, and respiratory tract |
|---|---|
| SDS | Available |
| Market Analysis Reports |