Online Database of Chemicals from Around the World
| BOC Sciences | USA | |||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Phosphoric acid 2,3-Dibromopropyldimethylester |
|---|---|
| Synonyms | Phosphoric Acid 2,3-Dibromopropyl Dimethyl Ester; 2,3-Dibromopropyl Dimethylphosphate; Phosphoric Acid, 2,3-Dibromopropyl Dimethyl Ester |
| Molecular Structure |  |
| Molecular Formula | C5H11Br2O4P |
| Molecular Weight | 325.92 |
| CAS Registry Number | 82682-96-0 |
| SMILES | C(O[P](OC)(OC)=O)C(CBr)Br |
| InChI | 1S/C5H11Br2O4P/c1-9-12(8,10-2)11-4-5(7)3-6/h5H,3-4H2,1-2H3 |
| InChIKey | LLXYHTKVLGMPBV-UHFFFAOYSA-N |
| Market Analysis Reports |