|
CAS#: 828-94-4 Product: 5-Methoxy-2,3-Dimethyl-1H-Indole No suppilers available for the product. |
| Name | 5-Methoxy-2,3-Dimethyl-1H-Indole |
|---|---|
| Synonyms | 2,3-Dimethyl-1H-Indol-5-Yl Methyl Ether; 5-Methoxy-2,3-Dimethylindole; 1H-Indole, 5-Methoxy-2,3-Dimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 |
| CAS Registry Number | 828-94-4 |
| SMILES | C1=C(C=CC2=C1C(=C([NH]2)C)C)OC |
| InChI | 1S/C11H13NO/c1-7-8(2)12-11-5-4-9(13-3)6-10(7)11/h4-6,12H,1-3H3 |
| InChIKey | GZSTUEGIANKNTE-UHFFFAOYSA-N |
| Density | 1.106g/cm3 (Cal.) |
|---|---|
| Boiling point | 325.325°C at 760 mmHg (Cal.) |
| Flash point | 119.168°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | A. R. Kennedy, J. N. Sherwood and P. A. Slavin. 5-Methoxy-2,3-dimethylindole, Acta Cryst. (2002). E58, o642-o643 |
|---|---|
| Market Analysis Reports |