|
CAS#: 828940-68-7 Product: N-[(2R)-2-Cyano-3-methyl-2-butanyl]-5-methyl-1,2-oxazole-4-carboxamide No suppilers available for the product. |
| Name | N-[(2R)-2-Cyano-3-methyl-2-butanyl]-5-methyl-1,2-oxazole-4-carboxamide |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 |
| CAS Registry Number | 828940-68-7 |
| SMILES | Cc1oncc1C(/O)=N/[C@@](C)(C#N)C(C)C |
| InChI | 1S/C11H15N3O2/c1-7(2)11(4,6-12)14-10(15)9-5-13-16-8(9)3/h5,7H,1-4H3,(H,14,15)/t11-/m0/s1 |
| InChIKey | KIEDOHHFMPEVRX-NSHDSACASA-N |
| Density | 1.146g/cm3 (Cal.) |
|---|---|
| Boiling point | 389.409°C at 760 mmHg (Cal.) |
| Flash point | 189.308°C (Cal.) |
| Refractive index | 1.541 (Cal.) |
| (1) | B. Zhong, X.-L. Mu, Z.-M. Li and H.-B. Song. N-(1-Cyano-1,2-dimethylpropyl)-5-methylisoxazole-4-carboxamide, Acta Cryst. (2004). E60, o1797-o1799 |
|---|---|
| Market Analysis Reports |