| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | |||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | 9-Diazo-9H-Fluorene |
|---|---|
| Synonyms | 2-Diazofluorene; 9H-Fluorene, 9-Diazo- (9Ci); Fluorene, 9-Diazo- (Van) (8Ci) |
| Molecular Structure | ![]() |
| Molecular Formula | C13H8N2 |
| Molecular Weight | 192.22 |
| CAS Registry Number | 832-80-4 |
| SMILES | [N+](=C2C1=CC=CC=C1C3=C2C=CC=C3)=[N-] |
| InChI | 1S/C13H8N2/c14-15-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1-8H |
| InChIKey | LOBSPZHDUJUOES-UHFFFAOYSA-N |
| (1) | Christopher C. Nawrat and Christopher J. Moody. Natural products containing a diazo group, Nat. Prod. Rep., 2011, 28, 1426. |
|---|---|
| Market Analysis Reports |