| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Biosynth AG. | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (71) 858-2020 | |||
![]() |
welcome@biosynth.ch | |||
| Chemical manufacturer | ||||
| Cayman Chemical Company | USA | |||
|---|---|---|---|---|
![]() |
+1 (734) 971-3335 | |||
![]() |
sales@caymanchem.com | |||
| Chemical manufacturer | ||||
| Classification | Analytical chemistry >> Standard >> Standard material |
|---|---|
| Name | Mescaline Hydrochloride |
| Synonyms | 2-(3,4,5-Trimethoxyphenyl)Ethylamine Hydrochloride; Mescaline Hydrochloride Salt; Nsc 172790 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H18ClNO3 |
| Molecular Weight | 247.72 |
| CAS Registry Number | 832-92-8 |
| EINECS | 212-626-3 |
| SMILES | [H+].C1=C(CCN)C=C(OC)C(=C1OC)OC.[Cl-] |
| InChI | 1S/C11H17NO3.ClH/c1-13-9-6-8(4-5-12)7-10(14-2)11(9)15-3;/h6-7H,4-5,12H2,1-3H3;1H |
| InChIKey | FVZVSNDNKMOYKF-UHFFFAOYSA-N |
| Boiling point | 312.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 145.8°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Felipe Reviriego, Pilar Navarro, Antonio Domènech and Enrique García-España. Effective complexation of psychotropic phenethylammonium salts from a disodium dipyrazolate salt of macrocyclic structure, J. Chem. Soc., Perkin Trans. 2, 2002, 0, 1634. |
|---|---|
| Market Analysis Reports |