|
CAS#: 83991-25-7 Product: Ambasilide No suppilers available for the product. |
| Name | Ambasilide |
|---|---|
| Synonyms | (4-Aminophenyl)-[7-(Benzyl)-3,7-Diazabicyclo[3.3.1]Nonan-3-Yl]Methanone; Ambasilide; Ambasilide [Inn] |
| Molecular Structure | ![]() |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 |
| CAS Registry Number | 83991-25-7 |
| SMILES | C4=C(C(N2CC3CN(CC1=CC=CC=C1)CC(C2)C3)=O)C=CC(=C4)N |
| InChI | 1S/C21H25N3O/c22-20-8-6-19(7-9-20)21(25)24-14-17-10-18(15-24)13-23(12-17)11-16-4-2-1-3-5-16/h1-9,17-18H,10-15,22H2 |
| InChIKey | DLNAKYFPFYUBDR-UHFFFAOYSA-N |
| Density | 1.196g/cm3 (Cal.) |
|---|---|
| Boiling point | 531.629°C at 760 mmHg (Cal.) |
| Flash point | 275.319°C (Cal.) |
| (1) | William Bains, Antranig Basman and Cat White. hERG binding specificity and binding site structure: evidence from a fragment-based evolutionary computing SAR study, Progress in Biophysics and Molecular Biology 2004, 86 (2), 205-233 |
|---|---|
| Market Analysis Reports |