| Advanced Asymmetrics, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (618) 476-3920 | |||
![]() |
sales@advancedasymmetrics.com | |||
| Chemical manufacturer | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | N2,N5-Diacetyl-L-Ornithine, Compound With 2-(Dimethylamino)Ethanol(1:1) |
|---|---|
| Synonyms | N2,N5-Diacetyl-L-Ornithine, Compound With 2-(Dimethylamino)Ethanol (1:1); N,N-DIACETYL-L-ORNITHINE |
| Molecular Structure | ![]() |
| Molecular Formula | C9H16N2O4 |
| Molecular Weight | 216.23 |
| CAS Registry Number | 84083-22-7 |
| EINECS | 282-072-5 |
| SMILES | NCCC[C@H](N(C(=O)C)C(=O)C)C(=O)O |
| InChI | 1S/C9H16N2O4/c1-6(12)11(7(2)13)8(9(14)15)4-3-5-10/h8H,3-5,10H2,1-2H3,(H,14,15)/t8-/m0/s1 |
| Market Analysis Reports |