| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Life Chemicals Inc. | Canada | |||
|---|---|---|---|---|
![]() |
+1 (905) 634-5212 | |||
![]() |
lifechemicals@lifechemicals.com | |||
| Chemical manufacturer since 2004 | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| ZereneX Molecular Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 4-Phenyl-1-(P-Tolylsulphonyl)Piperidine-4-Carboxylic Acid |
|---|---|
| Synonyms | 1-(4-Methylphenyl)Sulfonyl-4-Phenyl-Piperidine-4-Carboxylic Acid; 1-(4-Methylphenyl)Sulfonyl-4-Phenyl-4-Piperidinecarboxylic Acid; 1-(4-Methylphenyl)Sulfonyl-4-Phenyl-Isonipecotic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C19H21NO4S |
| Molecular Weight | 359.44 |
| CAS Registry Number | 84255-02-7 |
| EINECS | 282-549-8 |
| SMILES | C3=C(C2(CCN([S](C1=CC=C(C)C=C1)(=O)=O)CC2)C(O)=O)C=CC=C3 |
| InChI | 1S/C19H21NO4S/c1-15-7-9-17(10-8-15)25(23,24)20-13-11-19(12-14-20,18(21)22)16-5-3-2-4-6-16/h2-10H,11-14H2,1H3,(H,21,22) |
| InChIKey | RUPQNAVADOVYKW-UHFFFAOYSA-N |
| Density | 1.303g/cm3 (Cal.) |
|---|---|
| Melting point | 220-223°C (Expl.) |
| Boiling point | 557.33°C at 760 mmHg (Cal.) |
| Flash point | 290.863°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | S. S. Golotvin, E. Vodopianov, R. Pol, B. A. Lefebvre, A. J. Williams, R. D. Rutkowske and T. D. Spitzer. Automated structure verification based on a combination of 1D 1H NMR and 2D 1H–13C HSQC spectra, Magn. Reson. Chem. 2007, 45, 803–813 |
|---|---|
| Market Analysis Reports |