| Henan Ouber Technology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.oubertec.com | |||
![]() | +86 (371) 6532-2607 +86 18937141980 | |||
![]() | +86 (371) 6532-2607 | |||
![]() | anna.zhang@oubertec.com | |||
![]() | QQ Chat | |||
![]() | WeChat: 18937141980 | |||
| Chemical manufacturer since 2020 | ||||
| chemBlink Standard supplier since 2020 | ||||
| Classification | Flavors and spices >> Synthetic spice >> Lactone and oxygen-containing heterocyclic compound >> Furan and pyran |
|---|---|
| Name | 1-Chlorodibenzofuran |
| Molecular Structure | ![]() |
| Molecular Formula | C12H7ClO |
| Molecular Weight | 202.64 |
| CAS Registry Number | 84761-86-4 |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)C=CC=C3Cl |
| Solubility | 0.6234 mg/L (25 °C water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.703, Calc.* |
| Melting point | 93.65 °C |
| Boiling Point | 323.0±15.0 °C (760 mmHg), Calc.*, 325.68 °C |
| Flash Point | 149.1±20.4 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |