| Fluorochem Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Rieke Metals, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (402) 434-2775 | |||
![]() |
sales@riekemetals.com | |||
| Chemical manufacturer | ||||
| Name | Ethyl 4-(2-chloro-3-pyridinyl)-4-oxobutanoate |
|---|---|
| Synonyms | Ethyl 4-(2-chloro-3-pyridyl)-4-oxobutyrate; Ethyl 4-(2-chloropyridin-3-yl)-4-oxobutyrate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12ClNO3 |
| Molecular Weight | 241.67 |
| CAS Registry Number | 852063-32-2 |
| SMILES | CCOC(=O)CCC(=O)C1=C(N=CC=C1)Cl |
| InChI | 1S/C11H12ClNO3/c1-2-16-10(15)6-5-9(14)8-4-3-7-13-11(8)12/h3-4,7H,2,5-6H2,1H3 |
| InChIKey | HYJCUSFTYDWKMU-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 362.4±32.0°C at 760 mmHg (Cal.) |
| Flash point | 173.0±25.1°C (Cal.) |
| Refractive index | 1.521 (Cal.) |
| SDS | Available |
|---|---|
| (1) | Tahli Fenner, Jonathan M. White and Carl H. Schiesser. Preparation of 2,3-dihydroselenolo[2,3-b]pyridines and related compounds by free-radical means, Org. Biomol. Chem., 2006, 4, 466. |
|---|---|
| Market Analysis Reports |