| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Tocris Bioscience Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| Name | N-{1-[2-(4-Isothiocyanatophenyl)ethyl]-4-piperidinyl}-N-phenylpropanamide |
|---|---|
| Synonyms | [85951-63-9]; Fentanyl isothiocyanate; Fentanyl isothiocyanate | |
| Molecular Structure | ![]() |
| Molecular Formula | C23H27N3OS |
| Molecular Weight | 393.55 |
| CAS Registry Number | 85951-63-9 |
| SMILES | CCC(=O)N(C1CCN(CC1)CCC2=CC=C(C=C2)N=C=S)C3=CC=CC=C3 |
| InChI | 1S/C23H27N3OS/c1-2-23(27)26(21-6-4-3-5-7-21)22-13-16-25(17-14-22)15-12-19-8-10-20(11-9-19)24-18-28/h3-11,22H,2,12-17H2,1H3 |
| InChIKey | VDKBIFPJULZUPU-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 541.1±50.0°C at 760 mmHg (Cal.) |
| Flash point | 281.1±30.1°C (Cal.) |
| solubility | Soluble to 100 mM in ethanol and to 10 mM in DMSO |
| Market Analysis Reports |