Online Database of Chemicals from Around the World

1,2,3-trichloro-5-[1-(trifluoromethyl)ethenyl]-Benzene
[CAS 864736-87-8]

List of Suppliers
Beijing Eagle Sky Pharmatech Co., Ltd. China
www.eagleskypharmatech.com
+86 (10) 5979-9429
8875-5821
+86 (10) 5804-3698
sophia_818@126.com
contact@eagleskypharmatech.com
QQ Chat
Chemical manufacturer since 2009
chemBlink Standard supplier since 2010

Identification
ClassificationOrganic raw materials >> Organic fluorine compound
Name1,2,3-trichloro-5-[1-(trifluoromethyl)ethenyl]-Benzene
Molecular Structure1,2,3-trichloro-5-[1-(trifluoromethyl)ethenyl]-Benzene molecular structure (CAS 864736-87-8)
Molecular FormulaC9H4Cl3F3
Molecular Weight275.48
CAS Registry Number864736-87-8
SMILESC=C(C1=CC(=C(C(=C1)Cl)Cl)Cl)C(F)(F)F
Properties
SolubilitySparingly Soluble (2.4E-4 g/L) (25 °C), Calc.*
Density1.469±0.06 g/cm3 (20 °C 760 Torr), Calc.*
Index of Refraction1.505, Calc.*
Boiling Point306.7±42.0 °C (760 mmHg), Calc.*
Flash Point155.4±21.3 °C, Calc.*
*Calculated using Advanced Chemistry Development (ACD/Labs) Software V11.02 (©1994-2021 ACD/Labs)
Safety Data
Hazard Symbolssymbol   GHS07 Warning  Details
Risk StatementsH315-H319-H335  Details
Safety StatementsP261-P305+P351+P338-P302+P352  Details
SDSAvailable
up Discovery and Applications
1,2,3-Trichloro-5-[1-(trifluoromethyl)ethenyl]-benzene is a synthetic organic compound that belongs to the class of chlorinated aromatic compounds. This chemical has gained interest due to its unique molecular structure, which combines the reactivity of chlorinated benzene with the stability and electronic properties conferred by the trifluoromethyl group. The compound consists of a benzene ring substituted with chlorine atoms at positions 1, 2, and 3, and a trifluoromethylvinyl group at position 5. This configuration imparts significant chemical stability and versatility, making it useful in various fields, including materials science and agrochemical development.

The discovery of 1,2,3-trichloro-5-[1-(trifluoromethyl)ethenyl]-benzene was part of ongoing research into fluorinated compounds, which are known for their ability to enhance the properties of molecules in diverse applications. The trifluoromethyl group is a highly electronegative substituent that contributes to improved chemical resistance, solubility, and lipophilicity. These features are beneficial in applications where high stability and durability are required, such as in advanced materials and industrial chemicals.

In terms of applications, 1,2,3-trichloro-5-[1-(trifluoromethyl)ethenyl]-benzene is primarily used as an intermediate in the synthesis of specialty chemicals. Its chemical structure allows it to be easily incorporated into more complex molecules with targeted functionalities. One notable application is in the design of agrochemicals, where the compound serves as a precursor for the development of pesticides and herbicides. The trifluoromethylvinyl group improves the compound’s effectiveness by enhancing its bioactivity and resistance to environmental degradation, which is crucial for the long-term effectiveness of agrochemical formulations.

Furthermore, 1,2,3-trichloro-5-[1-(trifluoromethyl)ethenyl]-benzene plays a role in the synthesis of high-performance polymers. The introduction of trifluoromethyl groups into polymeric materials imparts significant improvements in chemical resistance, thermal stability, and mechanical strength. These enhanced properties are highly desirable in the electronics, coatings, and packaging industries, where polymers must withstand extreme conditions and offer excellent performance.

In the field of materials science, the compound is also utilized to create advanced fluorinated materials. These materials exhibit unique properties, such as low surface energy, high chemical resistance, and electrical insulating capabilities. These properties make them particularly useful in the electronics and semiconductor industries, where they are employed in the production of insulating layers, coatings, and electronic components that require superior durability and performance.

In conclusion, 1,2,3-trichloro-5-[1-(trifluoromethyl)ethenyl]-benzene is a versatile and valuable chemical compound with a wide range of applications in materials science, agrochemicals, and industrial processes. Its unique combination of chlorinated and trifluoromethylated functionalities allows it to serve as a building block for advanced materials and specialty chemicals, particularly in industries that require enhanced stability, resistance, and performance.

References

none
Market Analysis Reports
Related Products
1,2,4-Trichloro...  1,1,2-Trichloro...  Trichlorotriflu...  1,1,1-Trichloro...  1,1,2-Trichloro...  2,2,2-Trichloro...  2,3,6-Trichloro...  4,5,6-Trichloro...  4,6,7-Trichloro...  5,6,7-trichloro...  2,4,6-Trichloro...  2,3,6-Trichloro...  2,3,6-Trichloro...  1,2,2-Trichloro...  4,5,7-Trichloro...  4,6,8-Trichloro...  2,6,7-Trichloro...  1,2,3-Trichloro...  1,1,1-Trichloro...  1,1,3-Trichloro...