| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Classification | Organic raw materials >> Amino compound >> Cycloalkylamines, aromatic monoamines, aromatic polyamines and derivatives and salts |
|---|---|
| Name | N,N-Di-Boc-2-Iodoaniline |
| Synonyms | N,N-Di-Boc-2-iodoaniline; 644242_ALDRICH |
| Molecular Structure | ![]() |
| Molecular Formula | C16H22INO4 |
| Molecular Weight | 419.25 |
| CAS Registry Number | 870703-53-0 |
| SMILES | Ic1ccccc1N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | 1S/C16H22INO4/c1-15(2,3)21-13(19)18(14(20)22-16(4,5)6)12-10-8-7-9-11(12)17/h7-10H,1-6H3 |
| InChIKey | OLSDDNDJGXNWIZ-UHFFFAOYSA-N |
| Density | 1.452g/cm3 (Cal.) |
|---|---|
| Boiling point | 403.8°C at 760 mmHg (Cal.) |
| Flash point | 198°C (Cal.) |
| Refractive index | 1.565 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |