| Atomax Chemicals Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | L-Isoleucyl-L-valine |
|---|---|
| Synonyms | (2S,3S)-2 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.30 |
| CAS Registry Number | 875894-34-1 |
| SMILES | CC[C@H](C)[C@@H](C(=O)N[C@@H](C(C)C)C(=O)O)N |
| InChI | 1S/C11H22N2O3/c1-5-7(4)8(12)10(14)13-9(6(2)3)11(15)16/h6-9H,5,12H2,1-4H3,(H,13,14)(H,15,16)/t7-,8-,9-/m0/s1 |
| InChIKey | BCXBIONYYJCSDF-CIUDSAMLSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 421.9±30.0°C at 760 mmHg (Cal.) |
| Flash point | 209.0±24.6°C (Cal.) |
| Refractive index | 1.482 (Cal.) |
| (1) | Angiolina Comotti, Silvia Bracco, Gaetano Distefano and Piero Sozzani. Methane, carbon dioxide and hydrogen storage in nanoporous dipeptide-based materials, Chem. Commun., 2009, 284. |
|---|---|
| Market Analysis Reports |