| Synthonix, Inc. | USA | |||
|---|---|---|---|---|
![]() | www.synthonix.com | |||
![]() | +1 (919) 875-9277 | |||
![]() | +1 (919) 875-9601 | |||
![]() | info@synthonix.com | |||
| Chemical manufacturer | ||||
| Classification | Flavors and spices >> Synthetic spice >> Lactone and oxygen-containing heterocyclic compound >> Thiazole, thiophene and pyridine |
|---|---|
| Name | 5-Bromo-4-chloro-1H-pyrrolo[2,3-b]pyridine |
| Molecular Structure | ![]() |
| Molecular Formula | C7H4BrClN2 |
| Molecular Weight | 231.48 |
| CAS Registry Number | 876343-82-7 |
| EC Number | 870-637-4 |
| SMILES | C1=CNC2=NC=C(C(=C21)Cl)Br |
| Density | 1.9±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.730, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |
|---|---|
| Risk Statements | H302-H318 Details |
| Safety Statements | P264-P264+P265-P270-P280-P301+P317-P305+P354+P338-P317-P330-P501 Details |
| SDS | Available |
| Market Analysis Reports |