Online Database of Chemicals from Around the World
N-(2-(((2,3-Difluorophenyl)methyl)thio)-6-(((1R,2S)-2,3-dihydroxy-1-methylpropyl)oxy)-4-pyrimidinyl)-1-azetidinesulfonamide
[CAS 878385-84-3]
Identification| Name | N-(2-(((2,3-Difluorophenyl)methyl)thio)-6-(((1R,2S)-2,3-dihydroxy-1-methylpropyl)oxy)-4-pyrimidinyl)-1-azetidinesulfonamide |
|---|
|
| Molecular Structure |  |
| Molecular Formula | C18H22F2N4O5S2 |
| Molecular Weight | 476.52 |
| CAS Registry Number | 878385-84-3 |
| EC Number | 688-153-5 |
| SMILES | C[C@H]([C@H](CO)O)OC1=NC(=NC(=C1)NS(=O)(=O)N2CCC2)SCC3=C(C(=CC=C3)F)F |
|
Properties
| nsity | 1.6±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.651, Calc.* |
| Boiling Point | 680.5±65.0 °C (760 mmHg), Calc.* |
| Flash Point | 365.4±34.3 °C, Calc.* |
|
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
|
Safety Data
| Hazard Symbols | GHS08 Danger Details |
| Risk Statements | H360 Details |
| Safety Statements | P201-P202-P280-P308+P313-P405-P501 Details |
| Hazard Classification |
|
| Hazard | Class | Category Code | Hazard Statement |
| Specific target organ toxicity - repeated exposure | STOT RE | 2 | H373 |
|
| SDS | Available |
|
Related Products
1-(3,4-Difluoro... 1-(3,5-Difluoro... 1-(2,4-Difluoro... 1-(3,4-Difluoro... 1-(3,5-Difluoro... (2R,3S,5R)-2-(2... 3-(3,4-Difluoro... 2-(2,4-Difluoro... (2S,3S)-2-(2,4-... N-(3,5-Difluoro... 5-(2,4-Difluoro... 1-[(2,6-Difluor... (4R,5R)-5-(2,4-... (3R,4R)-4-(2,4-... (3R,4R)-4-(2,5-... (2R,3S)-2-(2,4-... (2S,3R)-2-(2,4-... 2-(2,4-Difluoro... [Difluoro(Pheny... 2-(3,4-Difluoro...