| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1,2,3-Trimethylnaphthalene |
|---|---|
| Synonyms | Naphthalene, 1,2,3-Trimethyl-; Naphthalene, 2,3,4-Trimethyl |
| Molecular Structure | ![]() |
| Molecular Formula | C13H14 |
| Molecular Weight | 170.25 |
| CAS Registry Number | 879-12-9 |
| EINECS | 212-902-3 |
| SMILES | C1=CC=CC2=C1C(=C(C(=C2)C)C)C |
| InChI | 1S/C13H14/c1-9-8-12-6-4-5-7-13(12)11(3)10(9)2/h4-8H,1-3H3 |
| InChIKey | RQHPYGROUIBUSW-UHFFFAOYSA-N |
| Density | 0.988g/cm3 (Cal.) |
|---|---|
| Boiling point | 292.694°C at 760 mmHg (Cal.) |
| Flash point | 132.387°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Jin-jun Lian, Yu Ren, Jian-min Chen, Tao Wang and Tian-tao Cheng. Distribution and source of alkyl polycyclic aromatic hydrocarbons in dustfall in Shanghai, China: the effect on the coastal area, J. Environ. Monit., 2009, 11, 187. |
|---|---|
| Market Analysis Reports |