| Fenhe Chemical Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.fenhechem.com | |||
![]() | +86 (021) 3392-6068 | |||
![]() | julius.wei@fenhechem.com | |||
| Chemical manufacturer since 1997 | ||||
| chemBlink Standard supplier since 2024 | ||||
| Classification | Pharmaceutical intermediate >> Heterocyclic compound intermediate >> Pyrimidine compound >> Amine |
|---|---|
| Name | 5,6-Dipropoxy-1,3-benzothiazol-2-amine |
| Molecular Structure | ![]() |
| Molecular Formula | C13H18N2O2S |
| Molecular Weight | 266.36 |
| CAS Registry Number | 885461-32-5 |
| SMILES | CCCOC1=C(C=C2C(=C1)N=C(S2)N)OCCC |
| Density | 1.2±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.605, Calc.* |
| Boiling Point | 410.3±48.0 °C (760 mmHg), Calc.* |
| Flash Point | 201.9±29.6 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
|
5,6-Dipropoxy-1,3-benzothiazol-2-amine is a distinctive chemical compound notable for its diverse applications and unique structure. This molecule features a benzothiazole ring system, which is a fused aromatic ring structure combining benzene and thiazole rings, modified with two propoxy groups and an amine substituent. The discovery of 5,6-Dipropoxy-1,3-benzothiazol-2-amine is part of broader research into functionalized benzothiazole derivatives. The benzothiazole ring is known for its stability and reactivity, making it a valuable framework in chemical synthesis. The addition of two propoxy groups at positions 5 and 6, along with an amine group at position 2, alters the chemical properties of the molecule and expands its potential applications. In medicinal chemistry, 5,6-Dipropoxy-1,3-benzothiazol-2-amine is being explored for its potential therapeutic properties. The benzothiazole core is associated with various biological activities, including antimicrobial and anticancer effects. The propoxy groups and the amine group can influence the compound's interaction with biological targets, potentially enhancing its efficacy and selectivity as a drug. Researchers are investigating how these structural modifications impact the molecule's ability to act against diseases, aiming to develop new and effective therapeutic agents. The compound also has promising applications in materials science. Its ability to act as a versatile intermediate in chemical reactions makes it useful for creating advanced materials. For instance, 5,6-Dipropoxy-1,3-benzothiazol-2-amine can be utilized in the synthesis of organic electronics, specialty polymers, and coatings. The propoxy groups contribute to the molecule’s solubility and stability, which can be advantageous in developing materials with tailored properties for various industrial applications. Moreover, 5,6-Dipropoxy-1,3-benzothiazol-2-amine serves as a valuable reagent in organic synthesis. The presence of propoxy and amine groups enables the compound to participate in a range of chemical transformations, facilitating the synthesis of complex molecules. This property makes it a useful tool for chemists developing new compounds and exploring novel synthetic routes. In summary, 5,6-Dipropoxy-1,3-benzothiazol-2-amine is a compound with significant potential due to its unique structure and reactivity. Its applications span medicinal chemistry, materials science, and organic synthesis, highlighting its importance in advancing research and industrial development. References none |
| Market Analysis Reports |