|
CAS#: 896-80-0 Product: 2,4-Dinitrophenyl Phenyl Sulfone No suppilers available for the product. |
| Name | 2,4-Dinitrophenyl Phenyl Sulfone |
|---|---|
| Synonyms | 2,4-Dinitro-1-Phenylsulfonyl-Benzene; Nsc629268; 2,4-Dinitrodiphenylsulphone |
| Molecular Structure | ![]() |
| Molecular Formula | C12H8N2O6S |
| Molecular Weight | 308.27 |
| CAS Registry Number | 896-80-0 |
| SMILES | C1=CC(=CC(=C1[S](C2=CC=CC=C2)(=O)=O)[N+]([O-])=O)[N+](=O)[O-] |
| InChI | 1S/C12H8N2O6S/c15-13(16)9-6-7-12(11(8-9)14(17)18)21(19,20)10-4-2-1-3-5-10/h1-8H |
| InChIKey | XGDSNKQDAAZGFA-UHFFFAOYSA-N |
| Density | 1.53g/cm3 (Cal.) |
|---|---|
| Boiling point | 519.939°C at 760 mmHg (Cal.) |
| Flash point | 268.249°C (Cal.) |
| (1) | J. Ellena, G. Punte and N. S. Nudelman. 2,4-Dinitrophenyl Phenyl Sulfone, Acta Cryst. (1996). C52, 2929-2932 |
|---|---|
| Market Analysis Reports |